C18H23N8OS+ — CID 155289409
N-[5-[[7-(5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-yl)-2,7-diazaspiro[3.4]octan-2-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 155289409) has the molecular formula C18H23N8OS+ and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[5-[[7-(5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-yl)-2,7-diazaspiro[3.4]octan-2-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[7-(5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-yl)-2,7-diazaspiro[3.4]octan-2-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 155289409 |
| Molecular Formula | C18H23N8OS+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[5-[[7-(5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium-7-yl)-2,7-diazaspiro[3.4]octan-2-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CC3(CCN(c4cc(C)nc5nc[nH][n+]45)C3)C2)s1 |
| InChI | InChI=1S/C18H22N8OS/c1-12-5-15(26-16(22-12)20-11-21-26)25-4-3-18(10-25)8-24(9-18)7-14-6-19-17(28-14)23-13(2)27/h5-6,11H,3-4,7-10H2,1-2H3,(H,19,23,27)/p+1 |
| InChIKey | DSEWUBFXIVTHKH-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|