About 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one
5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one (PubChem CID 155289588) has the molecular formula C17H13N3O3
and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one |
| PubChem CID | 155289588 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one |
| SMILES | O=C1NN=C(c2ccccc2)CC1=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N3O3/c21-17-14(10-12-6-8-15(9-7-12)20(22)23)11-16(18-19-17)13-4-2-1-3-5-13/h1-10H,11H2,(H,19,21) |
| InChIKey | WYXNWXZMPUGFEE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one?
The IUPAC name of 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one (CID 155289588) is 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one.
What is the SMILES notation for 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one?
The canonical SMILES for 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one is O=C1NN=C(c2ccccc2)CC1=Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one?
The InChIKey is WYXNWXZMPUGFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O3/c21-17-14(10-12-6-8-15(9-7-12)20(22)23)11-16(18-19-17)13-4-2-1-3-5-13/h1-10H,11H2,(H,19,21).
What are the key properties of 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one?
5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one has a molecular weight of 307.31 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-nitrophenyl)methylidene]-3-phenyl-1,4-dihydropyridazin-6-one is sourced from PubChem (CID 155289588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).