About 4-phenyldiazenylphenol
4-phenyldiazenylphenol (PubChem CID 15529) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-phenyldiazenylphenol.
Molecular Properties
| Compound Name | 4-phenyldiazenylphenol |
| PubChem CID | 15529 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-phenyldiazenylphenol |
| SMILES | Oc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2O/c15-12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10/h1-9,15H/b14-13+ |
| InChIKey | BEYOBVMPDRKTNR-BUHFOSPRSA-N |
| XLogP | 3.81 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyldiazenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyldiazenylphenol?
The IUPAC name of 4-phenyldiazenylphenol (CID 15529) is 4-phenyldiazenylphenol.
What is the SMILES notation for 4-phenyldiazenylphenol?
The canonical SMILES for 4-phenyldiazenylphenol is Oc1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 4-phenyldiazenylphenol?
The InChIKey is BEYOBVMPDRKTNR-BUHFOSPRSA-N. The full InChI is InChI=1S/C12H10N2O/c15-12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10/h1-9,15H/b14-13+.
What are the key properties of 4-phenyldiazenylphenol?
4-phenyldiazenylphenol has a molecular weight of 198.22 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyldiazenylphenol is sourced from PubChem (CID 15529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).