C12H16F3N3O4 — CID 155290039
1-(2-piperazin-1-ylethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (PubChem CID 155290039) has the molecular formula C12H16F3N3O4 and a molecular weight of 323.27 g/mol. Its IUPAC name is 1-(2-piperazin-1-ylethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-piperazin-1-ylethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155290039 |
| Molecular Formula | C12H16F3N3O4 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-(2-piperazin-1-ylethyl)pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1C=CC(=O)N1CCN1CCNCC1 |
| InChI | InChI=1S/C10H15N3O2.C2HF3O2/c14-9-1-2-10(15)13(9)8-7-12-5-3-11-4-6-12;3-2(4,5)1(6)7/h1-2,11H,3-8H2;(H,6,7) |
| InChIKey | VFDFVTYSRXWMNS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|