C27H52N2O6S — CID 155290144
bis(N-cyclohexylcyclohexanamine);(2R)-2-hydroxy-3-sulfopropanoic acid (PubChem CID 155290144) has the molecular formula C27H52N2O6S and a molecular weight of 532.79 g/mol. Its IUPAC name is bis(N-cyclohexylcyclohexanamine);(2R)-2-hydroxy-3-sulfopropanoic acid.
| Compound Name | bis(N-cyclohexylcyclohexanamine);(2R)-2-hydroxy-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 155290144 |
| Molecular Formula | C27H52N2O6S |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | bis(N-cyclohexylcyclohexanamine);(2R)-2-hydroxy-3-sulfopropanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.C1CCC(NC2CCCCC2)CC1.O=C(O)[C@@H](O)CS(=O)(=O)O |
| InChI | InChI=1S/2C12H23N.C3H6O6S/c2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;4-2(3(5)6)1-10(7,8)9/h2*11-13H,1-10H2;2,4H,1H2,(H,5,6)(H,7,8,9)/t;;2-/m..0/s1 |
| InChIKey | TUPKFVOXIJZUIT-VAGRMJETSA-N |
| XLogP | 4.80 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|