C12H9ClF2N2O2 — CID 155290443
ethyl 4-chloro-1-(2,6-difluorophenyl)pyrazole-3-carboxylate (PubChem CID 155290443) has the molecular formula C12H9ClF2N2O2 and a molecular weight of 286.67 g/mol. Its IUPAC name is ethyl 4-chloro-1-(2,6-difluorophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-chloro-1-(2,6-difluorophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 155290443 |
| Molecular Formula | C12H9ClF2N2O2 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | ethyl 4-chloro-1-(2,6-difluorophenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2c(F)cccc2F)cc1Cl |
| InChI | InChI=1S/C12H9ClF2N2O2/c1-2-19-12(18)10-7(13)6-17(16-10)11-8(14)4-3-5-9(11)15/h3-6H,2H2,1H3 |
| InChIKey | LKPXNZXMIBVIJL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |