About (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride
(2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride (PubChem CID 155290777) has the molecular formula C6H12ClNO3
and a molecular weight of 181.62 g/mol. Its IUPAC name is (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride |
| PubChem CID | 155290777 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride |
| SMILES | C[C@H]1CO[C@H](C(=O)O)CN1.Cl |
| InChI | InChI=1S/C6H11NO3.ClH/c1-4-3-10-5(2-7-4)6(8)9;/h4-5,7H,2-3H2,1H3,(H,8,9);1H/t4-,5-;/m0./s1 |
| InChIKey | DQLZEDUDEIHFGX-FHAQVOQBSA-N |
| XLogP | -0.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride?
The IUPAC name of (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride (CID 155290777) is (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride.
What is the SMILES notation for (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride?
The canonical SMILES for (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride is C[C@H]1CO[C@H](C(=O)O)CN1.Cl.
What is the InChIKey of (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride?
The InChIKey is DQLZEDUDEIHFGX-FHAQVOQBSA-N. The full InChI is InChI=1S/C6H11NO3.ClH/c1-4-3-10-5(2-7-4)6(8)9;/h4-5,7H,2-3H2,1H3,(H,8,9);1H/t4-,5-;/m0./s1.
What are the key properties of (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride?
(2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride has a molecular weight of 181.62 g/mol, XLogP of -0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-5-methylmorpholine-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 155290777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).