About S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate
S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate (PubChem CID 155291148) has the molecular formula C19H29NO6S2
and a molecular weight of 431.58 g/mol. Its IUPAC name is S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate.
Molecular Properties
| Compound Name | S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate |
| PubChem CID | 155291148 |
| Molecular Formula | C19H29NO6S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate |
| SMILES | CC(=O)SC[C@H](CCS(=O)(=O)OCC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29NO6S2/c1-15(21)27-13-17(10-11-28(23,24)26-14-19(2,3)4)20-18(22)25-12-16-8-6-5-7-9-16/h5-9,17H,10-14H2,1-4H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | FPKBNAGKSYFXTF-KRWDZBQOSA-N |
| XLogP | 3.34 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate?
The IUPAC name of S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate (CID 155291148) is S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate.
What is the SMILES notation for S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate?
The canonical SMILES for S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate is CC(=O)SC[C@H](CCS(=O)(=O)OCC(C)(C)C)NC(=O)OCc1ccccc1.
What is the InChIKey of S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate?
The InChIKey is FPKBNAGKSYFXTF-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H29NO6S2/c1-15(21)27-13-17(10-11-28(23,24)26-14-19(2,3)4)20-18(22)25-12-16-8-6-5-7-9-16/h5-9,17H,10-14H2,1-4H3,(H,20,22)/t17-/m0/s1.
What are the key properties of S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate?
S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate has a molecular weight of 431.58 g/mol, XLogP of 3.34, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2S)-4-(2,2-dimethylpropoxysulfonyl)-2-(phenylmethoxycarbonylamino)butyl] ethanethioate is sourced from PubChem (CID 155291148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).