C47H30N4O7 — CID 155291237
4-[10,20-bis(4-carboxyphenyl)-15-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid (PubChem CID 155291237) has the molecular formula C47H30N4O7 and a molecular weight of 762.78 g/mol. Its IUPAC name is 4-[10,20-bis(4-carboxyphenyl)-15-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,20-bis(4-carboxyphenyl)-15-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 155291237 |
| Molecular Formula | C47H30N4O7 |
| Molecular Weight | 762.78 g/mol |
| Exact Mass | 762.21 |
| IUPAC Name | 4-[10,20-bis(4-carboxyphenyl)-15-(4-hydroxyphenyl)-21,23-dihydroporphyrin-5-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccc(O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H30N4O7/c52-32-15-13-28(14-16-32)44-39-23-21-37(50-39)42(26-3-9-30(10-4-26)46(55)56)35-19-17-33(48-35)41(25-1-7-29(8-2-25)45(53)54)34-18-20-36(49-34)43(38-22-24-40(44)51-38)27-5-11-31(12-6-27)47(57)58/h1-24,48,51-52H,(H,53,54)(H,55,56)(H,57,58)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40- |
| InChIKey | YSNPJUBOBLHZMZ-LWQDQPMZSA-N |
| XLogP | 10.12 |
| TPSA | 189.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.78 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |