C25H35ClN4O7 — CID 155292685
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[2-(2-piperidin-4-yloxyethoxy)ethoxy]propanamide;hydrochloride (PubChem CID 155292685) has the molecular formula C25H35ClN4O7 and a molecular weight of 539.03 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[2-(2-piperidin-4-yloxyethoxy)ethoxy]propanamide;hydrochloride.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[2-(2-piperidin-4-yloxyethoxy)ethoxy]propanamide;hydrochloride |
|---|---|
| PubChem CID | 155292685 |
| Molecular Formula | C25H35ClN4O7 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-3-[2-(2-piperidin-4-yloxyethoxy)ethoxy]propanamide;hydrochloride |
| SMILES | Cl.O=C1CCC(N2Cc3c(NC(=O)CCOCCOCCOC4CCNCC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H34N4O7.ClH/c30-22-5-4-21(24(32)28-22)29-16-19-18(25(29)33)2-1-3-20(19)27-23(31)8-11-34-12-13-35-14-15-36-17-6-9-26-10-7-17;/h1-3,17,21,26H,4-16H2,(H,27,31)(H,28,30,32);1H |
| InChIKey | WJJMZVCAZJNZBG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|