C18H14ClN7O2 — CID 155293012
(Z)-N-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine (PubChem CID 155293012) has the molecular formula C18H14ClN7O2 and a molecular weight of 395.81 g/mol. Its IUPAC name is (Z)-N-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine.
| Compound Name | (Z)-N-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 155293012 |
| Molecular Formula | C18H14ClN7O2 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (Z)-N-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
| SMILES | Cn1nnnc1/C(=N\OCc1nnc(-c2cccc(Cl)c2)o1)c1ccccc1 |
| InChI | InChI=1S/C18H14ClN7O2/c1-26-17(21-24-25-26)16(12-6-3-2-4-7-12)23-27-11-15-20-22-18(28-15)13-8-5-9-14(19)10-13/h2-10H,11H2,1H3/b23-16- |
| InChIKey | USVWTOGYFQVFCC-KQWNVCNZSA-N |
| XLogP | 2.88 |
| TPSA | 104.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|