C17H31N3O — CID 155293166
(4S)-4-hepta-1,4-dienyl-1,5,9-triazacyclotridecan-2-one (PubChem CID 155293166) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is (4S)-4-hepta-1,4-dienyl-1,5,9-triazacyclotridecan-2-one.
| Compound Name | (4S)-4-hepta-1,4-dienyl-1,5,9-triazacyclotridecan-2-one |
|---|---|
| PubChem CID | 155293166 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | (4S)-4-hepta-1,4-dienyl-1,5,9-triazacyclotridecan-2-one |
| SMILES | CCC=CCC=C[C@@H]1CC(=O)NCCCCNCCCN1 |
| InChI | InChI=1S/C17H31N3O/c1-2-3-4-5-6-10-16-15-17(21)20-13-8-7-11-18-12-9-14-19-16/h3-4,6,10,16,18-19H,2,5,7-9,11-15H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | AOGXOBPXWJDHTR-MRXNPFEDSA-N |
| XLogP | 2.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|