C9H7ClN2O — CID 155294269
3-chloro-8-methoxy-1,5-naphthyridine (PubChem CID 155294269) has the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. Its IUPAC name is 3-chloro-8-methoxy-1,5-naphthyridine.
| Compound Name | 3-chloro-8-methoxy-1,5-naphthyridine |
|---|---|
| PubChem CID | 155294269 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 3-chloro-8-methoxy-1,5-naphthyridine |
| SMILES | COc1ccnc2cc(Cl)cnc12 |
| InChI | InChI=1S/C9H7ClN2O/c1-13-8-2-3-11-7-4-6(10)5-12-9(7)8/h2-5H,1H3 |
| InChIKey | RZCLRQZKFDJWQN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |