C31H49NO6S — CID 155294418
diethyl 8-cyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate (PubChem CID 155294418) has the molecular formula C31H49NO6S and a molecular weight of 563.80 g/mol. Its IUPAC name is diethyl 8-cyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate.
| Compound Name | diethyl 8-cyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate |
|---|---|
| PubChem CID | 155294418 |
| Molecular Formula | C31H49NO6S |
| Molecular Weight | 563.80 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | diethyl 8-cyano-2,2,14,14-tetramethyl-8-(4-methylphenyl)sulfonylpentadecanedioate |
| SMILES | CCOC(=O)C(C)(C)CCCCCC(C#N)(CCCCCC(C)(C)C(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H49NO6S/c1-8-37-27(33)29(4,5)20-12-10-14-22-31(24-32,39(35,36)26-18-16-25(3)17-19-26)23-15-11-13-21-30(6,7)28(34)38-9-2/h16-19H,8-15,20-23H2,1-7H3 |
| InChIKey | UNZZFGRAIJLLGW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.80 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|