C32H34N6O4S — CID 155294431
(13E)-10,17-dioxa-39-thia-2,25,27,28,35,36-hexazapentacyclo[32.2.2.15,9.118,22.126,29]hentetraconta-1(36),5(41),6,8,13,18,20,22(40),26,28,34,37-dodecaene-3,24-dione (PubChem CID 155294431) has the molecular formula C32H34N6O4S and a molecular weight of 598.73 g/mol. Its IUPAC name is (13E)-10,17-dioxa-39-thia-2,25,27,28,35,36-hexazapentacyclo[32.2.2.15,9.118,22.126,29]hentetraconta-1(36),5(41),6,8,13,18,20,22(40),26,28,34,37-dodecaene-3,24-dione.
| Compound Name | (13E)-10,17-dioxa-39-thia-2,25,27,28,35,36-hexazapentacyclo[32.2.2.15,9.118,22.126,29]hentetraconta-1(36),5(41),6,8,13,18,20,22(40),26,28,34,37-dodecaene-3,24-dione |
|---|---|
| PubChem CID | 155294431 |
| Molecular Formula | C32H34N6O4S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | (13E)-10,17-dioxa-39-thia-2,25,27,28,35,36-hexazapentacyclo[32.2.2.15,9.118,22.126,29]hentetraconta-1(36),5(41),6,8,13,18,20,22(40),26,28,34,37-dodecaene-3,24-dione |
| SMILES | O=C1Cc2cccc(c2)OCC/C=C\CCOc2cccc(c2)CC(=O)Nc2nnc(s2)CCCCc2ccc(nn2)N1 |
| InChI | InChI=1S/C32H34N6O4S/c39-29-21-23-9-7-12-26(19-23)41-17-5-1-2-6-18-42-27-13-8-10-24(20-27)22-30(40)34-32-38-37-31(43-32)14-4-3-11-25-15-16-28(33-29)36-35-25/h1-2,7-10,12-13,15-16,19-20H,3-6,11,14,17-18,21-22H2,(H,33,36,39)(H,34,38,40)/b2-1- |
| InChIKey | IFQQSJCIINHYQE-UPHRSURJSA-N |
| XLogP | 5.36 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|