About 3-methoxy-2,4-dipropylcyclopent-2-en-1-one
3-methoxy-2,4-dipropylcyclopent-2-en-1-one (PubChem CID 155294651) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-methoxy-2,4-dipropylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 3-methoxy-2,4-dipropylcyclopent-2-en-1-one |
| PubChem CID | 155294651 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 3-methoxy-2,4-dipropylcyclopent-2-en-1-one |
| SMILES | CCCC1=C(OC)C(CCC)CC1=O |
| InChI | InChI=1S/C12H20O2/c1-4-6-9-8-11(13)10(7-5-2)12(9)14-3/h9H,4-8H2,1-3H3 |
| InChIKey | INIGZQKPNHUFTJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,4-dipropylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,4-dipropylcyclopent-2-en-1-one?
The IUPAC name of 3-methoxy-2,4-dipropylcyclopent-2-en-1-one (CID 155294651) is 3-methoxy-2,4-dipropylcyclopent-2-en-1-one.
What is the SMILES notation for 3-methoxy-2,4-dipropylcyclopent-2-en-1-one?
The canonical SMILES for 3-methoxy-2,4-dipropylcyclopent-2-en-1-one is CCCC1=C(OC)C(CCC)CC1=O.
What is the InChIKey of 3-methoxy-2,4-dipropylcyclopent-2-en-1-one?
The InChIKey is INIGZQKPNHUFTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-4-6-9-8-11(13)10(7-5-2)12(9)14-3/h9H,4-8H2,1-3H3.
What are the key properties of 3-methoxy-2,4-dipropylcyclopent-2-en-1-one?
3-methoxy-2,4-dipropylcyclopent-2-en-1-one has a molecular weight of 196.29 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,4-dipropylcyclopent-2-en-1-one is sourced from PubChem (CID 155294651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).