C16H20F2N2O4 — CID 155294783
tert-butyl N-[4-[(2,4-difluorophenyl)methylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 155294783) has the molecular formula C16H20F2N2O4 and a molecular weight of 342.34 g/mol. Its IUPAC name is tert-butyl N-[4-[(2,4-difluorophenyl)methylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(2,4-difluorophenyl)methylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 155294783 |
| Molecular Formula | C16H20F2N2O4 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl N-[4-[(2,4-difluorophenyl)methylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)CC(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C16H20F2N2O4/c1-16(2,3)24-15(23)20-12(9-21)7-14(22)19-8-10-4-5-11(17)6-13(10)18/h4-6,9,12H,7-8H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | GPOGALQTPGADJM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|