C17H21N3O4 — CID 155294787
8-(2-methoxyphenyl)-3,3-dimethyl-9-nitro-2,4,7,8-tetrahydro-1H-pyrido[1,2-a]pyrimidin-6-one (PubChem CID 155294787) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 8-(2-methoxyphenyl)-3,3-dimethyl-9-nitro-2,4,7,8-tetrahydro-1H-pyrido[1,2-a]pyrimidin-6-one.
| Compound Name | 8-(2-methoxyphenyl)-3,3-dimethyl-9-nitro-2,4,7,8-tetrahydro-1H-pyrido[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 155294787 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 8-(2-methoxyphenyl)-3,3-dimethyl-9-nitro-2,4,7,8-tetrahydro-1H-pyrido[1,2-a]pyrimidin-6-one |
| SMILES | COc1ccccc1C1CC(=O)N2CC(C)(C)CNC2=C1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N3O4/c1-17(2)9-18-16-15(20(22)23)12(8-14(21)19(16)10-17)11-6-4-5-7-13(11)24-3/h4-7,12,18H,8-10H2,1-3H3 |
| InChIKey | HALXLDWHZZOQSY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|