C18H14F5N3O2 — CID 155294870
3-[(2,4-difluorophenyl)methyl]-4-oxo-N-(3,4,5-trifluorophenyl)-1,3-diazinane-1-carboxamide (PubChem CID 155294870) has the molecular formula C18H14F5N3O2 and a molecular weight of 399.32 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-4-oxo-N-(3,4,5-trifluorophenyl)-1,3-diazinane-1-carboxamide.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-4-oxo-N-(3,4,5-trifluorophenyl)-1,3-diazinane-1-carboxamide |
|---|---|
| PubChem CID | 155294870 |
| Molecular Formula | C18H14F5N3O2 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-4-oxo-N-(3,4,5-trifluorophenyl)-1,3-diazinane-1-carboxamide |
| SMILES | O=C1CCN(C(=O)Nc2cc(F)c(F)c(F)c2)CN1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C18H14F5N3O2/c19-11-2-1-10(13(20)5-11)8-26-9-25(4-3-16(26)27)18(28)24-12-6-14(21)17(23)15(22)7-12/h1-2,5-7H,3-4,8-9H2,(H,24,28) |
| InChIKey | XIGXGQPRZZJRDR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|