C30H33FN4O4S2 — CID 155295018
5-(dithiolan-3-yl)-N-[[1-[4-[4-(7-fluoro-4-oxochromen-2-yl)phenoxy]butyl]triazol-4-yl]methyl]pentanamide (PubChem CID 155295018) has the molecular formula C30H33FN4O4S2 and a molecular weight of 596.75 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[[1-[4-[4-(7-fluoro-4-oxochromen-2-yl)phenoxy]butyl]triazol-4-yl]methyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[[1-[4-[4-(7-fluoro-4-oxochromen-2-yl)phenoxy]butyl]triazol-4-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 155295018 |
| Molecular Formula | C30H33FN4O4S2 |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[[1-[4-[4-(7-fluoro-4-oxochromen-2-yl)phenoxy]butyl]triazol-4-yl]methyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCc1cn(CCCCOc2ccc(-c3cc(=O)c4ccc(F)cc4o3)cc2)nn1 |
| InChI | InChI=1S/C30H33FN4O4S2/c31-22-9-12-26-27(36)18-28(39-29(26)17-22)21-7-10-24(11-8-21)38-15-4-3-14-35-20-23(33-34-35)19-32-30(37)6-2-1-5-25-13-16-40-41-25/h7-12,17-18,20,25H,1-6,13-16,19H2,(H,32,37) |
| InChIKey | MMKPNZAHTWYNHJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|