About (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride
(2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride (PubChem CID 155295075) has the molecular formula C9H15ClF2N2O
and a molecular weight of 240.68 g/mol. Its IUPAC name is (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride |
| PubChem CID | 155295075 |
| Molecular Formula | C9H15ClF2N2O |
| Molecular Weight | 240.68 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCC1)[C@@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C9H14F2N2O.ClH/c10-9(11)4-7(12-5-9)8(14)13-6-2-1-3-6;/h6-7,12H,1-5H2,(H,13,14);1H/t7-;/m0./s1 |
| InChIKey | KHJGNQYJFPJLPH-FJXQXJEOSA-N |
| XLogP | 1.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.68 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
The IUPAC name of (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride (CID 155295075) is (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride.
What is the SMILES notation for (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
The canonical SMILES for (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride is Cl.O=C(NC1CCC1)[C@@H]1CC(F)(F)CN1.
What is the InChIKey of (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
The InChIKey is KHJGNQYJFPJLPH-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H14F2N2O.ClH/c10-9(11)4-7(12-5-9)8(14)13-6-2-1-3-6;/h6-7,12H,1-5H2,(H,13,14);1H/t7-;/m0./s1.
What are the key properties of (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride?
(2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride has a molecular weight of 240.68 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-cyclobutyl-4,4-difluoropyrrolidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 155295075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).