About tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate
tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate (PubChem CID 155295227) has the molecular formula C22H26N4O3
and a molecular weight of 394.48 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate |
| PubChem CID | 155295227 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccccc2C2C=CC3=NC(=O)NC3=C2)CC1 |
| InChI | InChI=1S/C22H26N4O3/c1-22(2,3)29-21(28)26-12-10-25(11-13-26)19-7-5-4-6-16(19)15-8-9-17-18(14-15)24-20(27)23-17/h4-9,14-15H,10-13H2,1-3H3,(H,24,27) |
| InChIKey | JEWFAYNBYQOQRW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate (CID 155295227) is tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(c2ccccc2C2C=CC3=NC(=O)NC3=C2)CC1.
What is the InChIKey of tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate?
The InChIKey is JEWFAYNBYQOQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O3/c1-22(2,3)29-21(28)26-12-10-25(11-13-26)19-7-5-4-6-16(19)15-8-9-17-18(14-15)24-20(27)23-17/h4-9,14-15H,10-13H2,1-3H3,(H,24,27).
What are the key properties of tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate?
tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate has a molecular weight of 394.48 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[2-(2-oxo-3,5-dihydrobenzimidazol-5-yl)phenyl]piperazine-1-carboxylate is sourced from PubChem (CID 155295227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).