C26H24F2N6O — CID 155295577
4-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyrimidin-5-amine (PubChem CID 155295577) has the molecular formula C26H24F2N6O and a molecular weight of 474.52 g/mol. Its IUPAC name is 4-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyrimidin-5-amine.
| Compound Name | 4-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 155295577 |
| Molecular Formula | C26H24F2N6O |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-[4-[(4aR)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyrimidin-5-amine |
| SMILES | Nc1cncnc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CCC4NCCO[C@@H]4C3)c2c1 |
| InChI | InChI=1S/C26H24F2N6O/c27-17-7-16(8-18(28)10-17)20-11-32-22-2-1-15(25-21(29)12-30-14-33-25)9-19(22)26(20)34-5-3-23-24(13-34)35-6-4-31-23/h1-2,7-12,14,23-24,31H,3-6,13,29H2/t23?,24-/m1/s1 |
| InChIKey | KCPNDJNAXUQVNP-XMMISQBUSA-N |
| XLogP | 3.79 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |