C27H24F2N4O2 — CID 155295590
2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyridin-3-ol (PubChem CID 155295590) has the molecular formula C27H24F2N4O2 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyridin-3-ol.
| Compound Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 155295590 |
| Molecular Formula | C27H24F2N4O2 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[4-[(4aR,8aR)-2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazin-6-yl]-3-(3,5-difluorophenyl)quinolin-6-yl]pyridin-3-ol |
| SMILES | Oc1cccnc1-c1ccc2ncc(-c3cc(F)cc(F)c3)c(N3CC[C@H]4OCCN[C@@H]4C3)c2c1 |
| InChI | InChI=1S/C27H24F2N4O2/c28-18-10-17(11-19(29)13-18)21-14-32-22-4-3-16(26-24(34)2-1-6-31-26)12-20(22)27(21)33-8-5-25-23(15-33)30-7-9-35-25/h1-4,6,10-14,23,25,30,34H,5,7-9,15H2/t23-,25-/m1/s1 |
| InChIKey | OHMFVJFRXWWGCK-ILBGXUMGSA-N |
| XLogP | 4.51 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |