C18H36NO8P — CID 155295757
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] heptanoate (PubChem CID 155295757) has the molecular formula C18H36NO8P and a molecular weight of 425.46 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] heptanoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] heptanoate |
|---|---|
| PubChem CID | 155295757 |
| Molecular Formula | C18H36NO8P |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@H](COC(=O)CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C18H36NO8P/c1-3-5-7-9-11-18(21)27-16(14-24-17(20)10-8-6-4-2)15-26-28(22,23)25-13-12-19/h16H,3-15,19H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | HAAQIWCDKVSGSM-MRXNPFEDSA-N |
| XLogP | 3.08 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|