C10H13BrO4 — CID 155296047
5-(1-bromopropyl)-3,5-dihydroxycyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 155296047) has the molecular formula C10H13BrO4 and a molecular weight of 277.11 g/mol. Its IUPAC name is 5-(1-bromopropyl)-3,5-dihydroxycyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-(1-bromopropyl)-3,5-dihydroxycyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 155296047 |
| Molecular Formula | C10H13BrO4 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 5-(1-bromopropyl)-3,5-dihydroxycyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CCC(Br)C1(O)C=C(O)C=C(C(=O)O)C1 |
| InChI | InChI=1S/C10H13BrO4/c1-2-8(11)10(15)4-6(9(13)14)3-7(12)5-10/h3,5,8,12,15H,2,4H2,1H3,(H,13,14) |
| InChIKey | WRELGVRCIKTILH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|