About (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate
(4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate (PubChem CID 155296339) has the molecular formula C9H3BrF3N3O3S
and a molecular weight of 370.11 g/mol. Its IUPAC name is (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate |
| PubChem CID | 155296339 |
| Molecular Formula | C9H3BrF3N3O3S |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate |
| SMILES | N#Cc1cnn2cc(OS(=O)(=O)C(F)(F)F)cc(Br)c12 |
| InChI | InChI=1S/C9H3BrF3N3O3S/c10-7-1-6(19-20(17,18)9(11,12)13)4-16-8(7)5(2-14)3-15-16/h1,3-4H |
| InChIKey | ITPBTYXPMMUIQF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate?
The IUPAC name of (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate (CID 155296339) is (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate.
What is the SMILES notation for (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate?
The canonical SMILES for (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate is N#Cc1cnn2cc(OS(=O)(=O)C(F)(F)F)cc(Br)c12.
What is the InChIKey of (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate?
The InChIKey is ITPBTYXPMMUIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3BrF3N3O3S/c10-7-1-6(19-20(17,18)9(11,12)13)4-16-8(7)5(2-14)3-15-16/h1,3-4H.
What are the key properties of (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate?
(4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate has a molecular weight of 370.11 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-3-cyanopyrazolo[1,5-a]pyridin-6-yl) trifluoromethanesulfonate is sourced from PubChem (CID 155296339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).