C22H30N6O — CID 155297123
8-[(3R,4R)-3-[[1-hydroxy-2-(1-methylpiperidin-3-yl)ethyl]amino]-4-methylpyrrolidin-1-yl]quinoxaline-5-carbonitrile (PubChem CID 155297123) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 8-[(3R,4R)-3-[[1-hydroxy-2-(1-methylpiperidin-3-yl)ethyl]amino]-4-methylpyrrolidin-1-yl]quinoxaline-5-carbonitrile.
| Compound Name | 8-[(3R,4R)-3-[[1-hydroxy-2-(1-methylpiperidin-3-yl)ethyl]amino]-4-methylpyrrolidin-1-yl]quinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 155297123 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 8-[(3R,4R)-3-[[1-hydroxy-2-(1-methylpiperidin-3-yl)ethyl]amino]-4-methylpyrrolidin-1-yl]quinoxaline-5-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3nccnc23)C[C@@H]1NC(O)CC1CCCN(C)C1 |
| InChI | InChI=1S/C22H30N6O/c1-15-12-28(19-6-5-17(11-23)21-22(19)25-8-7-24-21)14-18(15)26-20(29)10-16-4-3-9-27(2)13-16/h5-8,15-16,18,20,26,29H,3-4,9-10,12-14H2,1-2H3/t15-,16?,18+,20?/m1/s1 |
| InChIKey | DRQLFCOJNQVYGH-LOPSVYGOSA-N |
| XLogP | 1.97 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|