C21H28FN — CID 155297891
N-[(3E,5E)-5-(4,5-diethylcyclohexa-1,5-dien-1-yl)-3-fluoro-6,7-dimethylocta-1,3,5,7-tetraen-2-yl]methanimine (PubChem CID 155297891) has the molecular formula C21H28FN and a molecular weight of 313.46 g/mol. Its IUPAC name is N-[(3E,5E)-5-(4,5-diethylcyclohexa-1,5-dien-1-yl)-3-fluoro-6,7-dimethylocta-1,3,5,7-tetraen-2-yl]methanimine.
| Compound Name | N-[(3E,5E)-5-(4,5-diethylcyclohexa-1,5-dien-1-yl)-3-fluoro-6,7-dimethylocta-1,3,5,7-tetraen-2-yl]methanimine |
|---|---|
| PubChem CID | 155297891 |
| Molecular Formula | C21H28FN |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[(3E,5E)-5-(4,5-diethylcyclohexa-1,5-dien-1-yl)-3-fluoro-6,7-dimethylocta-1,3,5,7-tetraen-2-yl]methanimine |
| SMILES | C=NC(=C)/C(F)=C\C(C1=CCC(CC)C(CC)=C1)=C(\C)C(=C)C |
| InChI | InChI=1S/C21H28FN/c1-8-17-10-11-19(12-18(17)9-2)20(15(5)14(3)4)13-21(22)16(6)23-7/h11-13,17H,3,6-10H2,1-2,4-5H3/b20-15+,21-13+ |
| InChIKey | KRGGEYIPVXITOP-AJMPDFPPSA-N |
| XLogP | 6.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|