C13H21NO2 — CID 155297910
(2E,5Z)-6-methanimidoyl-2,4,5,7-tetramethylocta-2,5-dienoic acid (PubChem CID 155297910) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (2E,5Z)-6-methanimidoyl-2,4,5,7-tetramethylocta-2,5-dienoic acid.
| Compound Name | (2E,5Z)-6-methanimidoyl-2,4,5,7-tetramethylocta-2,5-dienoic acid |
|---|---|
| PubChem CID | 155297910 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (2E,5Z)-6-methanimidoyl-2,4,5,7-tetramethylocta-2,5-dienoic acid |
| SMILES | [H]/N=C/C(=C(/C)C(C)/C=C(\C)C(=O)O)C(C)C |
| InChI | InChI=1S/C13H21NO2/c1-8(2)12(7-14)11(5)9(3)6-10(4)13(15)16/h6-9,14H,1-5H3,(H,15,16)/b10-6+,12-11+,14-7+ |
| InChIKey | OPQLBNWCXMJRJM-NAQARJFXSA-N |
| XLogP | 3.28 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|