About 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine
2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine (PubChem CID 155298079) has the molecular formula C15H26N10
and a molecular weight of 346.44 g/mol. Its IUPAC name is 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine |
| PubChem CID | 155298079 |
| Molecular Formula | C15H26N10 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine |
| SMILES | CNCCCn1cc(CNc2nc(N)cc(N3CCNCC3)n2)nn1 |
| InChI | InChI=1S/C15H26N10/c1-17-3-2-6-25-11-12(22-23-25)10-19-15-20-13(16)9-14(21-15)24-7-4-18-5-8-24/h9,11,17-18H,2-8,10H2,1H3,(H3,16,19,20,21) |
| InChIKey | OGQXLOHYQQLTSE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine?
The IUPAC name of 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine (CID 155298079) is 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine is CNCCCn1cc(CNc2nc(N)cc(N3CCNCC3)n2)nn1.
What is the InChIKey of 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine?
The InChIKey is OGQXLOHYQQLTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N10/c1-17-3-2-6-25-11-12(22-23-25)10-19-15-20-13(16)9-14(21-15)24-7-4-18-5-8-24/h9,11,17-18H,2-8,10H2,1H3,(H3,16,19,20,21).
What are the key properties of 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine?
2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine has a molecular weight of 346.44 g/mol, XLogP of -0.72, 8 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[[1-[3-(methylamino)propyl]triazol-4-yl]methyl]-6-piperazin-1-ylpyrimidine-2,4-diamine is sourced from PubChem (CID 155298079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).