C32H42FN5O3 — CID 155298506
(4-tert-butylcyclohexa-1,3-dien-1-yl)-[5-[5-fluoro-2-[[4-(2-methoxyethoxy)phenyl]methylamino]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]methanone (PubChem CID 155298506) has the molecular formula C32H42FN5O3 and a molecular weight of 563.72 g/mol. Its IUPAC name is (4-tert-butylcyclohexa-1,3-dien-1-yl)-[5-[5-fluoro-2-[[4-(2-methoxyethoxy)phenyl]methylamino]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]methanone.
| Compound Name | (4-tert-butylcyclohexa-1,3-dien-1-yl)-[5-[5-fluoro-2-[[4-(2-methoxyethoxy)phenyl]methylamino]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 155298506 |
| Molecular Formula | C32H42FN5O3 |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | (4-tert-butylcyclohexa-1,3-dien-1-yl)-[5-[5-fluoro-2-[[4-(2-methoxyethoxy)phenyl]methylamino]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]methanone |
| SMILES | COCCOc1ccc(CNc2ncc(F)c(N3CCC4C(CCN4C(=O)C4=CC=C(C(C)(C)C)CC4)C3)n2)cc1 |
| InChI | InChI=1S/C32H42FN5O3/c1-32(2,3)25-9-7-23(8-10-25)30(39)38-16-13-24-21-37(15-14-28(24)38)29-27(33)20-35-31(36-29)34-19-22-5-11-26(12-6-22)41-18-17-40-4/h5-7,9,11-12,20,24,28H,8,10,13-19,21H2,1-4H3,(H,34,35,36) |
| InChIKey | UINODWYRSIBPLA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|