About 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol
2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol (PubChem CID 155298849) has the molecular formula C17H22F2O2S
and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol.
Molecular Properties
| Compound Name | 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol |
| PubChem CID | 155298849 |
| Molecular Formula | C17H22F2O2S |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol |
| SMILES | Cc1cc(C2CCC(C3OCC(S)CO3)CC2)cc(F)c1F |
| InChI | InChI=1S/C17H22F2O2S/c1-10-6-13(7-15(18)16(10)19)11-2-4-12(5-3-11)17-20-8-14(22)9-21-17/h6-7,11-12,14,17,22H,2-5,8-9H2,1H3 |
| InChIKey | ZBAPAESFOYVEHK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol?
The IUPAC name of 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol (CID 155298849) is 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol.
What is the SMILES notation for 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol?
The canonical SMILES for 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol is Cc1cc(C2CCC(C3OCC(S)CO3)CC2)cc(F)c1F.
What is the InChIKey of 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol?
The InChIKey is ZBAPAESFOYVEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2O2S/c1-10-6-13(7-15(18)16(10)19)11-2-4-12(5-3-11)17-20-8-14(22)9-21-17/h6-7,11-12,14,17,22H,2-5,8-9H2,1H3.
What are the key properties of 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol?
2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol has a molecular weight of 328.42 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-difluoro-5-methylphenyl)cyclohexyl]-1,3-dioxane-5-thiol is sourced from PubChem (CID 155298849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).