C28H37N5O3 — CID 155298921
7-[(1-acetylpiperidin-4-yl)amino]-2-[(2S)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4,4-dimethyl-3H-2,6-naphthyridin-1-one (PubChem CID 155298921) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is 7-[(1-acetylpiperidin-4-yl)amino]-2-[(2S)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4,4-dimethyl-3H-2,6-naphthyridin-1-one.
| Compound Name | 7-[(1-acetylpiperidin-4-yl)amino]-2-[(2S)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4,4-dimethyl-3H-2,6-naphthyridin-1-one |
|---|---|
| PubChem CID | 155298921 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 7-[(1-acetylpiperidin-4-yl)amino]-2-[(2S)-2-hydroxy-2-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]ethyl]-4,4-dimethyl-3H-2,6-naphthyridin-1-one |
| SMILES | CC(=O)N1CCC(Nc2cc3c(cn2)C(C)(C)CN(C[C@H](O)[C@@H]2Cc4ccccc4CN2)C3=O)CC1 |
| InChI | InChI=1S/C28H37N5O3/c1-18(34)32-10-8-21(9-11-32)31-26-13-22-23(15-30-26)28(2,3)17-33(27(22)36)16-25(35)24-12-19-6-4-5-7-20(19)14-29-24/h4-7,13,15,21,24-25,29,35H,8-12,14,16-17H2,1-3H3,(H,30,31)/t24-,25-/m0/s1 |
| InChIKey | XYWYBTMWNJNVPU-DQEYMECFSA-N |
| XLogP | 2.31 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |