About 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene
2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene (PubChem CID 155299130) has the molecular formula C27H19ClO
and a molecular weight of 394.90 g/mol. Its IUPAC name is 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene.
Molecular Properties
| Compound Name | 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene |
| PubChem CID | 155299130 |
| Molecular Formula | C27H19ClO |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene |
| SMILES | C#Cc1cccc2ccccc12.CC#Cc1ccc(Oc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClO.C12H8/c1-2-6-12-9-10-15(14(16)11-12)17-13-7-4-3-5-8-13;1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3-5,7-11H,1H3;1,3-9H |
| InChIKey | NFXWSGDJPWQOQW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene?
The IUPAC name of 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene (CID 155299130) is 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene.
What is the SMILES notation for 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene?
The canonical SMILES for 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene is C#Cc1cccc2ccccc12.CC#Cc1ccc(Oc2ccccc2)c(Cl)c1.
What is the InChIKey of 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene?
The InChIKey is NFXWSGDJPWQOQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClO.C12H8/c1-2-6-12-9-10-15(14(16)11-12)17-13-7-4-3-5-8-13;1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3-5,7-11H,1H3;1,3-9H.
What are the key properties of 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene?
2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene has a molecular weight of 394.90 g/mol, XLogP of 7.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-phenoxy-4-prop-1-ynylbenzene;1-ethynylnaphthalene is sourced from PubChem (CID 155299130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).