C19H24BrF3N4O2 — CID 155299286
[[(5R)-8-bromo-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]-(5-tert-butyl-1,2,4-oxadiazol-3-yl)methanol (PubChem CID 155299286) has the molecular formula C19H24BrF3N4O2 and a molecular weight of 477.33 g/mol. Its IUPAC name is [[(5R)-8-bromo-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]-(5-tert-butyl-1,2,4-oxadiazol-3-yl)methanol.
| Compound Name | [[(5R)-8-bromo-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]-(5-tert-butyl-1,2,4-oxadiazol-3-yl)methanol |
|---|---|
| PubChem CID | 155299286 |
| Molecular Formula | C19H24BrF3N4O2 |
| Molecular Weight | 477.33 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [[(5R)-8-bromo-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]amino]-(5-tert-butyl-1,2,4-oxadiazol-3-yl)methanol |
| SMILES | CC(C)(C)c1nc(C(O)N[C@@H]2CCN(CC(F)(F)F)Cc3cc(Br)ccc32)no1 |
| InChI | InChI=1S/C19H24BrF3N4O2/c1-18(2,3)17-25-15(26-29-17)16(28)24-14-6-7-27(10-19(21,22)23)9-11-8-12(20)4-5-13(11)14/h4-5,8,14,16,24,28H,6-7,9-10H2,1-3H3/t14-,16?/m1/s1 |
| InChIKey | RELNAVUUFOVTAH-IURRXHLWSA-N |
| XLogP | 4.22 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|