C19H31F3N4OS — CID 155299367
4-methyl-N-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide (PubChem CID 155299367) has the molecular formula C19H31F3N4OS and a molecular weight of 420.55 g/mol. Its IUPAC name is 4-methyl-N-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide.
| Compound Name | 4-methyl-N-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide |
|---|---|
| PubChem CID | 155299367 |
| Molecular Formula | C19H31F3N4OS |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-methyl-N-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-N-propylhexanamide |
| SMILES | CCCN(CCCNc1nc(SC)ncc1C(F)(F)F)C(=O)CCC(C)CC |
| InChI | InChI=1S/C19H31F3N4OS/c1-5-11-26(16(27)9-8-14(3)6-2)12-7-10-23-17-15(19(20,21)22)13-24-18(25-17)28-4/h13-14H,5-12H2,1-4H3,(H,23,24,25) |
| InChIKey | INXDQIUNPLHILR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|