C16H26N2 — CID 155299561
N'-[(Z,2E)-2-ethylidenepent-3-enyl]-5,6-dimethylcyclohex-2-ene-1-carboximidamide (PubChem CID 155299561) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N'-[(Z,2E)-2-ethylidenepent-3-enyl]-5,6-dimethylcyclohex-2-ene-1-carboximidamide.
| Compound Name | N'-[(Z,2E)-2-ethylidenepent-3-enyl]-5,6-dimethylcyclohex-2-ene-1-carboximidamide |
|---|---|
| PubChem CID | 155299561 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N'-[(Z,2E)-2-ethylidenepent-3-enyl]-5,6-dimethylcyclohex-2-ene-1-carboximidamide |
| SMILES | C/C=C\C(=C/C)C/N=C(\N)C1C=CCC(C)C1C |
| InChI | InChI=1S/C16H26N2/c1-5-8-14(6-2)11-18-16(17)15-10-7-9-12(3)13(15)4/h5-8,10,12-13,15H,9,11H2,1-4H3,(H2,17,18)/b8-5-,14-6+ |
| InChIKey | LBXGUEHEYFTHOL-RJANOSGQSA-N |
| XLogP | 3.71 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|