C15H20O3 — CID 15529986
(3aS,6aR,10aR)-3a-(1-methoxyethenyl)-6,6a,7,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-2-one (PubChem CID 15529986) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3aS,6aR,10aR)-3a-(1-methoxyethenyl)-6,6a,7,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-2-one.
| Compound Name | (3aS,6aR,10aR)-3a-(1-methoxyethenyl)-6,6a,7,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-2-one |
|---|---|
| PubChem CID | 15529986 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3aS,6aR,10aR)-3a-(1-methoxyethenyl)-6,6a,7,8,9,10-hexahydro-3H-benzo[h][1]benzofuran-2-one |
| SMILES | C=C(OC)[C@]12C=CC[C@H]3CCCC[C@@]31OC(=O)C2 |
| InChI | InChI=1S/C15H20O3/c1-11(17-2)14-8-5-7-12-6-3-4-9-15(12,14)18-13(16)10-14/h5,8,12H,1,3-4,6-7,9-10H2,2H3/t12-,14-,15-/m1/s1 |
| InChIKey | VVBIRJNXPYKMPP-BPLDGKMQSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|