About 4-hydroxy-3,5-diiodobenzonitrile
4-hydroxy-3,5-diiodobenzonitrile (PubChem CID 15530) has the molecular formula C7H3I2NO
and a molecular weight of 370.92 g/mol. Its IUPAC name is 4-hydroxy-3,5-diiodobenzonitrile.
Molecular Properties
| Compound Name | 4-hydroxy-3,5-diiodobenzonitrile |
| PubChem CID | 15530 |
| Molecular Formula | C7H3I2NO |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.83 |
| IUPAC Name | 4-hydroxy-3,5-diiodobenzonitrile |
| SMILES | N#Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C7H3I2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
| InChIKey | NRXQIUSYPAHGNM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3,5-diiodobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,5-diiodobenzonitrile?
The IUPAC name of 4-hydroxy-3,5-diiodobenzonitrile (CID 15530) is 4-hydroxy-3,5-diiodobenzonitrile.
What is the SMILES notation for 4-hydroxy-3,5-diiodobenzonitrile?
The canonical SMILES for 4-hydroxy-3,5-diiodobenzonitrile is N#Cc1cc(I)c(O)c(I)c1.
What is the InChIKey of 4-hydroxy-3,5-diiodobenzonitrile?
The InChIKey is NRXQIUSYPAHGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3I2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H.
What are the key properties of 4-hydroxy-3,5-diiodobenzonitrile?
4-hydroxy-3,5-diiodobenzonitrile has a molecular weight of 370.92 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,5-diiodobenzonitrile is sourced from PubChem (CID 15530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).