C44H34N4 — CID 155300133
3-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]quinazolin-2-yl]-24,24-dimethyl-3,6-diazahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene (PubChem CID 155300133) has the molecular formula C44H34N4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 3-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]quinazolin-2-yl]-24,24-dimethyl-3,6-diazahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene.
| Compound Name | 3-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]quinazolin-2-yl]-24,24-dimethyl-3,6-diazahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene |
|---|---|
| PubChem CID | 155300133 |
| Molecular Formula | C44H34N4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 3-[4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]quinazolin-2-yl]-24,24-dimethyl-3,6-diazahexacyclo[15.7.0.02,10.04,9.011,16.018,23]tetracosa-1(17),2(10),4(9),5,7,11,13,15,18,20,22-undecaene |
| SMILES | C/C=C\C(=C/C)c1ccc(-c2nc(-n3c4cnccc4c4c5ccccc5c5c(c43)C(C)(C)c3ccccc3-5)nc3ccccc23)cc1 |
| InChI | InChI=1S/C44H34N4/c1-5-13-27(6-2)28-20-22-29(23-21-28)41-33-17-10-12-19-36(33)46-43(47-41)48-37-26-45-25-24-34(37)39-31-15-8-7-14-30(31)38-32-16-9-11-18-35(32)44(3,4)40(38)42(39)48/h5-26H,1-4H3/b13-5-,27-6+ |
| InChIKey | LFGGFKZHPIGPLC-ZQZBGEAVSA-N |
| XLogP | 11.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|