C28H34FN — CID 155300341
3-(1-but-1-enyl-2-ethylcyclopropyl)-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene (PubChem CID 155300341) has the molecular formula C28H34FN and a molecular weight of 403.59 g/mol. Its IUPAC name is 3-(1-but-1-enyl-2-ethylcyclopropyl)-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene.
| Compound Name | 3-(1-but-1-enyl-2-ethylcyclopropyl)-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene |
|---|---|
| PubChem CID | 155300341 |
| Molecular Formula | C28H34FN |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 3-(1-but-1-enyl-2-ethylcyclopropyl)-6-fluoro-8,8,10,10-tetramethyl-15-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,9(16),11,13-hexaene |
| SMILES | CCC=CC1(C2CC=C(F)C3=C2c2nccc4c2=C(C(C)(C)C=4)C3(C)C)CC1CC |
| InChI | InChI=1S/C28H34FN/c1-7-9-13-28(16-18(28)8-2)19-10-11-20(29)23-22(19)24-21-17(12-14-30-24)15-26(3,4)25(21)27(23,5)6/h9,11-15,18-19H,7-8,10,16H2,1-6H3 |
| InChIKey | WQLNXERUPOUEQY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|