C19H16Cl2N2OS — CID 155300419
N-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-5-(2-chlorophenoxy)-1,3-benzothiazol-6-amine (PubChem CID 155300419) has the molecular formula C19H16Cl2N2OS and a molecular weight of 391.32 g/mol. Its IUPAC name is N-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-5-(2-chlorophenoxy)-1,3-benzothiazol-6-amine.
| Compound Name | N-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-5-(2-chlorophenoxy)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 155300419 |
| Molecular Formula | C19H16Cl2N2OS |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-[(2Z,4Z)-3-chlorohexa-2,4-dien-2-yl]-5-(2-chlorophenoxy)-1,3-benzothiazol-6-amine |
| SMILES | C/C=C\C(Cl)=C(/C)Nc1cc2scnc2cc1Oc1ccccc1Cl |
| InChI | InChI=1S/C19H16Cl2N2OS/c1-3-6-13(20)12(2)23-15-10-19-16(22-11-25-19)9-18(15)24-17-8-5-4-7-14(17)21/h3-11,23H,1-2H3/b6-3-,13-12- |
| InChIKey | XDODTTQYTAPUMB-SPUVLZJKSA-N |
| XLogP | 7.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|