C22H16N4O — CID 155300433
methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzenecarboximidate (PubChem CID 155300433) has the molecular formula C22H16N4O and a molecular weight of 352.40 g/mol. Its IUPAC name is methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzenecarboximidate.
| Compound Name | methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 155300433 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | methyl 2-(3,11,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-8-yl)benzenecarboximidate |
| SMILES | [H]/N=C(\OC)c1ccccc1-c1cc2[nH]c3ccncc3c2c2ncccc12 |
| InChI | InChI=1S/C22H16N4O/c1-27-22(23)15-6-3-2-5-13(15)16-11-19-20(21-14(16)7-4-9-25-21)17-12-24-10-8-18(17)26-19/h2-12,23,26H,1H3/b23-22- |
| InChIKey | QKSJCQCKFSADQB-FCQUAONHSA-N |
| XLogP | 4.90 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|