C66H77NOS — CID 15530059
1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-nitrososulfanylbenzene (PubChem CID 15530059) has the molecular formula C66H77NOS and a molecular weight of 932.41 g/mol. Its IUPAC name is 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-nitrososulfanylbenzene.
| Compound Name | 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-nitrososulfanylbenzene |
|---|---|
| PubChem CID | 15530059 |
| Molecular Formula | C66H77NOS |
| Molecular Weight | 932.41 g/mol |
| Exact Mass | 931.57 |
| IUPAC Name | 1,3-bis[3,5-bis[2,6-di(propan-2-yl)phenyl]phenyl]-2-nitrososulfanylbenzene |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cc(-c2cccc(-c3cc(-c4c(C(C)C)cccc4C(C)C)cc(-c4c(C(C)C)cccc4C(C)C)c3)c2SN=O)cc(-c2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C66H77NOS/c1-38(2)52-22-17-23-53(39(3)4)62(52)48-32-46(33-49(36-48)63-54(40(5)6)24-18-25-55(63)41(7)8)60-30-21-31-61(66(60)69-67-68)47-34-50(64-56(42(9)10)26-19-27-57(64)43(11)12)37-51(35-47)65-58(44(13)14)28-20-29-59(65)45(15)16/h17-45H,1-16H3 |
| InChIKey | AXNREVUBNKPXOZ-UHFFFAOYSA-N |
| XLogP | 21.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.41 |
| LogP ≤ 5 | 21.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|