C25H44O3 — CID 155301837
(4,8-diethyl-4,8,9,12-tetramethyl-11-oxotridec-12-en-2-yl) 2-methylprop-2-enoate (PubChem CID 155301837) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is (4,8-diethyl-4,8,9,12-tetramethyl-11-oxotridec-12-en-2-yl) 2-methylprop-2-enoate.
| Compound Name | (4,8-diethyl-4,8,9,12-tetramethyl-11-oxotridec-12-en-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155301837 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | (4,8-diethyl-4,8,9,12-tetramethyl-11-oxotridec-12-en-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)CC(C)C(C)(CC)CCCC(C)(CC)CC(C)OC(=O)C(=C)C |
| InChI | InChI=1S/C25H44O3/c1-11-24(9,17-21(8)28-23(27)19(5)6)14-13-15-25(10,12-2)20(7)16-22(26)18(3)4/h20-21H,3,5,11-17H2,1-2,4,6-10H3 |
| InChIKey | RGCGPJZBOQCIEU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|