About 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine
1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine (PubChem CID 155301882) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine |
| PubChem CID | 155301882 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine |
| SMILES | CC/C=C(\C=C/CN1CCN(C)CC1)OC |
| InChI | InChI=1S/C13H24N2O/c1-4-6-13(16-3)7-5-8-15-11-9-14(2)10-12-15/h5-7H,4,8-12H2,1-3H3/b7-5-,13-6+ |
| InChIKey | FFYIJGHKQMXSPO-IILXRZLBSA-N |
| XLogP | 1.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine?
The IUPAC name of 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine (CID 155301882) is 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine.
What is the SMILES notation for 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine?
The canonical SMILES for 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine is CC/C=C(\C=C/CN1CCN(C)CC1)OC.
What is the InChIKey of 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine?
The InChIKey is FFYIJGHKQMXSPO-IILXRZLBSA-N. The full InChI is InChI=1S/C13H24N2O/c1-4-6-13(16-3)7-5-8-15-11-9-14(2)10-12-15/h5-7H,4,8-12H2,1-3H3/b7-5-,13-6+.
What are the key properties of 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine?
1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine has a molecular weight of 224.35 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z,4E)-4-methoxyhepta-2,4-dienyl]-4-methylpiperazine is sourced from PubChem (CID 155301882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).