C18H21FN4O2 — CID 155302297
4-tert-butyl-N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 155302297) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-tert-butyl-N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 155302297 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-tert-butyl-N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC(C)(C)C1=CCN(C(=O)Nc2nnc(-c3ccc(F)cc3)o2)CC1 |
| InChI | InChI=1S/C18H21FN4O2/c1-18(2,3)13-8-10-23(11-9-13)17(24)20-16-22-21-15(25-16)12-4-6-14(19)7-5-12/h4-8H,9-11H2,1-3H3,(H,20,22,24) |
| InChIKey | BOMGNVXVOXQBQH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|