C14H24F3NO3 — CID 155302439
(2R,3R,4R,5S)-2-methyl-1-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol (PubChem CID 155302439) has the molecular formula C14H24F3NO3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155302439 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]methyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@H]1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C14H24F3NO3/c1-8-12(20)13(21)11(19)7-18(8)6-9-3-2-4-10(5-9)14(15,16)17/h8-13,19-21H,2-7H2,1H3/t8-,9+,10-,11+,12-,13-/m1/s1 |
| InChIKey | BKRBHJOFVJAMFT-HDLKOFKZSA-N |
| XLogP | 1.14 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |