C16H23F3N4O3 — CID 155302679
(2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 155302679) has the molecular formula C16H23F3N4O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155302679 |
| Molecular Formula | C16H23F3N4O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@@H]1CCN(c2cncnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H23F3N4O3/c1-9-13(25)14(26)12(24)7-23(9)6-10-2-3-22(5-10)11-4-20-8-21-15(11)16(17,18)19/h4,8-10,12-14,24-26H,2-3,5-7H2,1H3/t9-,10-,12+,13-,14-/m1/s1 |
| InChIKey | ISIDJOSFEJZKIG-IGJDLRFWSA-N |
| XLogP | 0.11 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |